C13H18IN5 — CID 105317276
[1-(3-iodophenyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105317276) has the molecular formula C13H18IN5 and a molecular weight of 371.23 g/mol. Its IUPAC name is [1-(3-iodophenyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(3-iodophenyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105317276 |
| Molecular Formula | C13H18IN5 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | [1-(3-iodophenyl)-2-(2-propan-2-yl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CC(C)n1ncnc1CC(NN)c1cccc(I)c1 |
| InChI | InChI=1S/C13H18IN5/c1-9(2)19-13(16-8-17-19)7-12(18-15)10-4-3-5-11(14)6-10/h3-6,8-9,12,18H,7,15H2,1-2H3 |
| InChIKey | CGJPFIFBWCPBFF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|