C6H7N3S — CID 105253743
1-(1,3-thiazol-5-yl)prop-2-ynylhydrazine (PubChem CID 105253743) has the molecular formula C6H7N3S and a molecular weight of 153.21 g/mol. Its IUPAC name is 1-(1,3-thiazol-5-yl)prop-2-ynylhydrazine.
| Compound Name | 1-(1,3-thiazol-5-yl)prop-2-ynylhydrazine |
|---|---|
| PubChem CID | 105253743 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 1-(1,3-thiazol-5-yl)prop-2-ynylhydrazine |
| SMILES | C#CC(NN)c1cncs1 |
| InChI | InChI=1S/C6H7N3S/c1-2-5(9-7)6-3-8-4-10-6/h1,3-5,9H,7H2 |
| InChIKey | IJXRJDXAOPSHQR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|