C25H30N2O3 — CID 10525401
(1S,2R,3S,4R)-2-methyl-2-N,3-N-bis[(1S)-1-phenylethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 10525401) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (1S,2R,3S,4R)-2-methyl-2-N,3-N-bis[(1S)-1-phenylethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | (1S,2R,3S,4R)-2-methyl-2-N,3-N-bis[(1S)-1-phenylethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 10525401 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (1S,2R,3S,4R)-2-methyl-2-N,3-N-bis[(1S)-1-phenylethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1[C@H]2CC[C@H](O2)[C@]1(C)C(=O)N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O3/c1-16(18-10-6-4-7-11-18)26-23(28)22-20-14-15-21(30-20)25(22,3)24(29)27-17(2)19-12-8-5-9-13-19/h4-13,16-17,20-22H,14-15H2,1-3H3,(H,26,28)(H,27,29)/t16-,17-,20+,21-,22-,25-/m0/s1 |
| InChIKey | PCPKHIBJWJBYHQ-MOAJRDGDSA-N |
| XLogP | 3.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |