C20H24O9 — CID 10525498
1-(3,6-dihydroxy-2,4-dimethoxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-3,3-dimethoxypropan-1-one (PubChem CID 10525498) has the molecular formula C20H24O9 and a molecular weight of 408.40 g/mol. Its IUPAC name is 1-(3,6-dihydroxy-2,4-dimethoxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-3,3-dimethoxypropan-1-one.
| Compound Name | 1-(3,6-dihydroxy-2,4-dimethoxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-3,3-dimethoxypropan-1-one |
|---|---|
| PubChem CID | 10525498 |
| Molecular Formula | C20H24O9 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-(3,6-dihydroxy-2,4-dimethoxyphenyl)-2-(3-hydroxy-4-methoxyphenyl)-3,3-dimethoxypropan-1-one |
| SMILES | COc1ccc(C(C(=O)c2c(O)cc(OC)c(O)c2OC)C(OC)OC)cc1O |
| InChI | InChI=1S/C20H24O9/c1-25-13-7-6-10(8-11(13)21)15(20(28-4)29-5)18(24)16-12(22)9-14(26-2)17(23)19(16)27-3/h6-9,15,20-23H,1-5H3 |
| InChIKey | KCGXSKUZIHZPDQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|