C10H22N2O2S — CID 105258751
[1-(1,1-dioxothiolan-3-yl)-4-methylpentyl]hydrazine (PubChem CID 105258751) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)-4-methylpentyl]hydrazine.
| Compound Name | [1-(1,1-dioxothiolan-3-yl)-4-methylpentyl]hydrazine |
|---|---|
| PubChem CID | 105258751 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)-4-methylpentyl]hydrazine |
| SMILES | CC(C)CCC(NN)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H22N2O2S/c1-8(2)3-4-10(12-11)9-5-6-15(13,14)7-9/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | OIPCEJTZHPRBIT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|