C12H21BrN4O2S — CID 105258943
[2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine (PubChem CID 105258943) has the molecular formula C12H21BrN4O2S and a molecular weight of 365.30 g/mol. Its IUPAC name is [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105258943 |
| Molecular Formula | C12H21BrN4O2S |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-(1,1-dioxothiolan-3-yl)ethyl]hydrazine |
| SMILES | CCc1nn(C)c(CC(NN)C2CCS(=O)(=O)C2)c1Br |
| InChI | InChI=1S/C12H21BrN4O2S/c1-3-9-12(13)11(17(2)16-9)6-10(15-14)8-4-5-20(18,19)7-8/h8,10,15H,3-7,14H2,1-2H3 |
| InChIKey | MKQIAGAKGZLFAG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|