C12H18BrN3 — CID 105263475
4-bromo-2-(1-hydrazinyl-4-methylpent-4-enyl)aniline (PubChem CID 105263475) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is 4-bromo-2-(1-hydrazinyl-4-methylpent-4-enyl)aniline.
| Compound Name | 4-bromo-2-(1-hydrazinyl-4-methylpent-4-enyl)aniline |
|---|---|
| PubChem CID | 105263475 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-bromo-2-(1-hydrazinyl-4-methylpent-4-enyl)aniline |
| SMILES | C=C(C)CCC(NN)c1cc(Br)ccc1N |
| InChI | InChI=1S/C12H18BrN3/c1-8(2)3-6-12(16-15)10-7-9(13)4-5-11(10)14/h4-5,7,12,16H,1,3,6,14-15H2,2H3 |
| InChIKey | NHIPYCGERUHHQG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|