C7H14F2N2 — CID 105265079
(1,1-difluoro-5-methylhex-5-en-2-yl)hydrazine (PubChem CID 105265079) has the molecular formula C7H14F2N2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (1,1-difluoro-5-methylhex-5-en-2-yl)hydrazine.
| Compound Name | (1,1-difluoro-5-methylhex-5-en-2-yl)hydrazine |
|---|---|
| PubChem CID | 105265079 |
| Molecular Formula | C7H14F2N2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | (1,1-difluoro-5-methylhex-5-en-2-yl)hydrazine |
| SMILES | C=C(C)CCC(NN)C(F)F |
| InChI | InChI=1S/C7H14F2N2/c1-5(2)3-4-6(11-10)7(8)9/h6-7,11H,1,3-4,10H2,2H3 |
| InChIKey | IUUISPYRVGJXRR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|