C10H20F2N2O — CID 105265218
[2,2-difluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine (PubChem CID 105265218) has the molecular formula C10H20F2N2O and a molecular weight of 222.28 g/mol. Its IUPAC name is [2,2-difluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine.
| Compound Name | [2,2-difluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265218 |
| Molecular Formula | C10H20F2N2O |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [2,2-difluoro-1-(2,2,5,5-tetramethyloxolan-3-yl)ethyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)C(F)F)C(C)(C)O1 |
| InChI | InChI=1S/C10H20F2N2O/c1-9(2)5-6(10(3,4)15-9)7(14-13)8(11)12/h6-8,14H,5,13H2,1-4H3 |
| InChIKey | WZGRFJDPCYFNSC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|