C10H15N3 — CID 105266309
1-(3,5-dimethyl-2-pyridinyl)prop-2-enylhydrazine (PubChem CID 105266309) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(3,5-dimethyl-2-pyridinyl)prop-2-enylhydrazine.
| Compound Name | 1-(3,5-dimethyl-2-pyridinyl)prop-2-enylhydrazine |
|---|---|
| PubChem CID | 105266309 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-(3,5-dimethyl-2-pyridinyl)prop-2-enylhydrazine |
| SMILES | C=CC(NN)c1ncc(C)cc1C |
| InChI | InChI=1S/C10H15N3/c1-4-9(13-11)10-8(3)5-7(2)6-12-10/h4-6,9,13H,1,11H2,2-3H3 |
| InChIKey | NODCYJPVCXEGIK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|