C10H22N2O — CID 105272241
(5-methoxy-2,6-dimethylhept-2-en-4-yl)hydrazine (PubChem CID 105272241) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (5-methoxy-2,6-dimethylhept-2-en-4-yl)hydrazine.
| Compound Name | (5-methoxy-2,6-dimethylhept-2-en-4-yl)hydrazine |
|---|---|
| PubChem CID | 105272241 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (5-methoxy-2,6-dimethylhept-2-en-4-yl)hydrazine |
| SMILES | COC(C(C)C)C(C=C(C)C)NN |
| InChI | InChI=1S/C10H22N2O/c1-7(2)6-9(12-11)10(13-5)8(3)4/h6,8-10,12H,11H2,1-5H3 |
| InChIKey | GUOKIZPDOMWEMD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|