C10H20N2O — CID 102654548
[1-(2,3-dihydrofuran-5-yl)-2,3-dimethylbutyl]hydrazine (PubChem CID 102654548) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is [1-(2,3-dihydrofuran-5-yl)-2,3-dimethylbutyl]hydrazine.
| Compound Name | [1-(2,3-dihydrofuran-5-yl)-2,3-dimethylbutyl]hydrazine |
|---|---|
| PubChem CID | 102654548 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | [1-(2,3-dihydrofuran-5-yl)-2,3-dimethylbutyl]hydrazine |
| SMILES | CC(C)C(C)C(NN)C1=CCCO1 |
| InChI | InChI=1S/C10H20N2O/c1-7(2)8(3)10(12-11)9-5-4-6-13-9/h5,7-8,10,12H,4,6,11H2,1-3H3 |
| InChIKey | KVXFTNFJTMWSOS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|