C25H23N3O5 — CID 10527307
2-[(2E,4Z)-5-[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexa-2,4-dienyl]-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 10527307) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-[(2E,4Z)-5-[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexa-2,4-dienyl]-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-[(2E,4Z)-5-[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexa-2,4-dienyl]-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 10527307 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-[(2E,4Z)-5-[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]hexa-2,4-dienyl]-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | C/C(=C/C=C/Cn1oc(=O)[nH]c1=O)c1cccc(OCc2nc(-c3ccccc3)oc2C)c1 |
| InChI | InChI=1S/C25H23N3O5/c1-17(9-6-7-14-28-24(29)27-25(30)33-28)20-12-8-13-21(15-20)31-16-22-18(2)32-23(26-22)19-10-4-3-5-11-19/h3-13,15H,14,16H2,1-2H3,(H,27,29,30)/b7-6+,17-9- |
| InChIKey | DOHJSHKZLQHBRN-ZBJXGCGXSA-N |
| XLogP | 4.33 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|