C12H21N3O2S — CID 105276575
[1-(4-methoxyoxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105276575) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is [1-(4-methoxyoxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(4-methoxyoxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105276575 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [1-(4-methoxyoxan-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | COC1(C(Cc2nc(C)cs2)NN)CCOCC1 |
| InChI | InChI=1S/C12H21N3O2S/c1-9-8-18-11(14-9)7-10(15-13)12(16-2)3-5-17-6-4-12/h8,10,15H,3-7,13H2,1-2H3 |
| InChIKey | FNGZLZWKNZUVDN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|