C22H39O8P — CID 10528033
ethyl (2Z,4S)-3-diethoxyphosphoryl-4-methoxy-7-methyl-6-(oxan-2-yloxymethyl)octa-2,6-dienoate (PubChem CID 10528033) has the molecular formula C22H39O8P and a molecular weight of 462.52 g/mol. Its IUPAC name is ethyl (2Z,4S)-3-diethoxyphosphoryl-4-methoxy-7-methyl-6-(oxan-2-yloxymethyl)octa-2,6-dienoate.
| Compound Name | ethyl (2Z,4S)-3-diethoxyphosphoryl-4-methoxy-7-methyl-6-(oxan-2-yloxymethyl)octa-2,6-dienoate |
|---|---|
| PubChem CID | 10528033 |
| Molecular Formula | C22H39O8P |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | ethyl (2Z,4S)-3-diethoxyphosphoryl-4-methoxy-7-methyl-6-(oxan-2-yloxymethyl)octa-2,6-dienoate |
| SMILES | CCOC(=O)/C=C(/[C@H](CC(COC1CCCCO1)=C(C)C)OC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H39O8P/c1-7-26-21(23)15-20(31(24,29-8-2)30-9-3)19(25-6)14-18(17(4)5)16-28-22-12-10-11-13-27-22/h15,19,22H,7-14,16H2,1-6H3/b20-15-/t19-,22?/m0/s1 |
| InChIKey | XRQQUYSMHDUWAW-WBPHVKNASA-N |
| XLogP | 4.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|