C23H34O8 — CID 25194278
1-O-ethyl 5-O-methyl (Z,4Z)-4-[(Z)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)but-2-enylidene]pent-2-enedioate (PubChem CID 25194278) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (Z,4Z)-4-[(Z)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)but-2-enylidene]pent-2-enedioate.
| Compound Name | 1-O-ethyl 5-O-methyl (Z,4Z)-4-[(Z)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)but-2-enylidene]pent-2-enedioate |
|---|---|
| PubChem CID | 25194278 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (Z,4Z)-4-[(Z)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)but-2-enylidene]pent-2-enedioate |
| SMILES | CCOC(=O)/C=C\C(=C\C(=C\COC1CCCCO1)COC1CCCCO1)C(=O)OC |
| InChI | InChI=1S/C23H34O8/c1-3-27-20(24)11-10-19(23(25)26-2)16-18(17-31-22-9-5-7-14-29-22)12-15-30-21-8-4-6-13-28-21/h10-12,16,21-22H,3-9,13-15,17H2,1-2H3/b11-10-,18-12-,19-16- |
| InChIKey | OJWXSHXLUGNGRL-JUSGJKDQSA-N |
| XLogP | 3.22 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|