C24H20N2O6S — CID 10528106
(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(2-phenylethylcarbamoyl)benzoate (PubChem CID 10528106) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(2-phenylethylcarbamoyl)benzoate.
| Compound Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(2-phenylethylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 10528106 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 4-(2-phenylethylcarbamoyl)benzoate |
| SMILES | O=C(NCCc1ccccc1)c1ccc(C(=O)OCN2C(=O)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C24H20N2O6S/c27-22(25-15-14-17-6-2-1-3-7-17)18-10-12-19(13-11-18)24(29)32-16-26-23(28)20-8-4-5-9-21(20)33(26,30)31/h1-13H,14-16H2,(H,25,27) |
| InChIKey | HCLABVCOLVGUKN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |