C18H15ClF6N4O2 — CID 10528296
N-[3-(butylcarbamoyl)-5-(trifluoromethyl)phenyl]-2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 10528296) has the molecular formula C18H15ClF6N4O2 and a molecular weight of 468.79 g/mol. Its IUPAC name is N-[3-(butylcarbamoyl)-5-(trifluoromethyl)phenyl]-2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | N-[3-(butylcarbamoyl)-5-(trifluoromethyl)phenyl]-2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10528296 |
| Molecular Formula | C18H15ClF6N4O2 |
| Molecular Weight | 468.79 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-[3-(butylcarbamoyl)-5-(trifluoromethyl)phenyl]-2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | CCCCNC(=O)c1cc(NC(=O)c2cnc(Cl)nc2C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15ClF6N4O2/c1-2-3-4-26-14(30)9-5-10(17(20,21)22)7-11(6-9)28-15(31)12-8-27-16(19)29-13(12)18(23,24)25/h5-8H,2-4H2,1H3,(H,26,30)(H,28,31) |
| InChIKey | MOKNGVJROBEXLK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|