C29H32FN3O2 — CID 10528476
11-[2-[4-[4-(diethylamino)butyl]phenyl]acetyl]-7-fluoro-5H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 10528476) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is 11-[2-[4-[4-(diethylamino)butyl]phenyl]acetyl]-7-fluoro-5H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 11-[2-[4-[4-(diethylamino)butyl]phenyl]acetyl]-7-fluoro-5H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 10528476 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 11-[2-[4-[4-(diethylamino)butyl]phenyl]acetyl]-7-fluoro-5H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CCN(CC)CCCCc1ccc(CC(=O)N2c3ccccc3NC(=O)c3c(F)cccc32)cc1 |
| InChI | InChI=1S/C29H32FN3O2/c1-3-32(4-2)19-8-7-10-21-15-17-22(18-16-21)20-27(34)33-25-13-6-5-12-24(25)31-29(35)28-23(30)11-9-14-26(28)33/h5-6,9,11-18H,3-4,7-8,10,19-20H2,1-2H3,(H,31,35) |
| InChIKey | JIXWLSPXLGFCQJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|