C18H30N2 — CID 105292728
[1-(1-ethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine (PubChem CID 105292728) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is [1-(1-ethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine.
| Compound Name | [1-(1-ethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105292728 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | [1-(1-ethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine |
| SMILES | CCC1(C(Cc2c(C)cc(C)cc2C)NN)CCCC1 |
| InChI | InChI=1S/C18H30N2/c1-5-18(8-6-7-9-18)17(20-19)12-16-14(3)10-13(2)11-15(16)4/h10-11,17,20H,5-9,12,19H2,1-4H3 |
| InChIKey | JQABWWLPEGDOQP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|