C17H28N2 — CID 105329172
[2-(2,6-dimethylphenyl)-1-(1-ethylcyclopentyl)ethyl]hydrazine (PubChem CID 105329172) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is [2-(2,6-dimethylphenyl)-1-(1-ethylcyclopentyl)ethyl]hydrazine.
| Compound Name | [2-(2,6-dimethylphenyl)-1-(1-ethylcyclopentyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105329172 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | [2-(2,6-dimethylphenyl)-1-(1-ethylcyclopentyl)ethyl]hydrazine |
| SMILES | CCC1(C(Cc2c(C)cccc2C)NN)CCCC1 |
| InChI | InChI=1S/C17H28N2/c1-4-17(10-5-6-11-17)16(19-18)12-15-13(2)8-7-9-14(15)3/h7-9,16,19H,4-6,10-12,18H2,1-3H3 |
| InChIKey | SYMUCESQWUJAGN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|