C25H37F2NO7 — CID 10529423
benzyl (Z)-3,3-difluoro-4-(2-methoxyethoxymethoxy)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-4-enoate (PubChem CID 10529423) has the molecular formula C25H37F2NO7 and a molecular weight of 501.57 g/mol. Its IUPAC name is benzyl (Z)-3,3-difluoro-4-(2-methoxyethoxymethoxy)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-4-enoate.
| Compound Name | benzyl (Z)-3,3-difluoro-4-(2-methoxyethoxymethoxy)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-4-enoate |
|---|---|
| PubChem CID | 10529423 |
| Molecular Formula | C25H37F2NO7 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | benzyl (Z)-3,3-difluoro-4-(2-methoxyethoxymethoxy)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-4-enoate |
| SMILES | COCCOCO/C(=C\C(C)(C)C)C(F)(F)C(NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H37F2NO7/c1-23(2,3)15-19(34-17-32-14-13-31-7)25(26,27)20(28-22(30)35-24(4,5)6)21(29)33-16-18-11-9-8-10-12-18/h8-12,15,20H,13-14,16-17H2,1-7H3,(H,28,30)/b19-15- |
| InChIKey | SCUVTEHMVFRZPC-CYVLTUHYSA-N |
| XLogP | 4.83 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|