C15H18BrFN2S — CID 105296704
[1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpentan-2-yl]hydrazine (PubChem CID 105296704) has the molecular formula C15H18BrFN2S and a molecular weight of 357.29 g/mol. Its IUPAC name is [1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpentan-2-yl]hydrazine.
| Compound Name | [1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105296704 |
| Molecular Formula | C15H18BrFN2S |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [1-(2-bromo-4-fluorophenyl)-5-thiophen-2-ylpentan-2-yl]hydrazine |
| SMILES | NNC(CCCc1cccs1)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C15H18BrFN2S/c16-15-10-12(17)7-6-11(15)9-13(19-18)3-1-4-14-5-2-8-20-14/h2,5-8,10,13,19H,1,3-4,9,18H2 |
| InChIKey | NZXNDELUFSNHIQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|