C13H22N2S — CID 105335936
(7-methyl-1-thiophen-2-yloct-7-en-4-yl)hydrazine (PubChem CID 105335936) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is (7-methyl-1-thiophen-2-yloct-7-en-4-yl)hydrazine.
| Compound Name | (7-methyl-1-thiophen-2-yloct-7-en-4-yl)hydrazine |
|---|---|
| PubChem CID | 105335936 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (7-methyl-1-thiophen-2-yloct-7-en-4-yl)hydrazine |
| SMILES | C=C(C)CCC(CCCc1cccs1)NN |
| InChI | InChI=1S/C13H22N2S/c1-11(2)8-9-12(15-14)5-3-6-13-7-4-10-16-13/h4,7,10,12,15H,1,3,5-6,8-9,14H2,2H3 |
| InChIKey | CACFFOWMNINJOF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|