C31H36ClNO4 — CID 10530025
4-[6-(4-chlorophenoxy)hexoxy]-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)benzamide (PubChem CID 10530025) has the molecular formula C31H36ClNO4 and a molecular weight of 522.09 g/mol. Its IUPAC name is 4-[6-(4-chlorophenoxy)hexoxy]-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)benzamide.
| Compound Name | 4-[6-(4-chlorophenoxy)hexoxy]-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)benzamide |
|---|---|
| PubChem CID | 10530025 |
| Molecular Formula | C31H36ClNO4 |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 4-[6-(4-chlorophenoxy)hexoxy]-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)benzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(OCCCCCCOc3ccc(Cl)cc3)cc2)c2c1CC(C)(C)O2 |
| InChI | InChI=1S/C31H36ClNO4/c1-21-19-22(2)28(29-27(21)20-31(3,4)37-29)33-30(34)23-9-13-25(14-10-23)35-17-7-5-6-8-18-36-26-15-11-24(32)12-16-26/h9-16,19H,5-8,17-18,20H2,1-4H3,(H,33,34) |
| InChIKey | DTWOCKYJSMUFFN-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|