C19H13F9O5S — CID 10530075
ethyl 3-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)phenyl]benzoate (PubChem CID 10530075) has the molecular formula C19H13F9O5S and a molecular weight of 524.36 g/mol. Its IUPAC name is ethyl 3-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)phenyl]benzoate.
| Compound Name | ethyl 3-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)phenyl]benzoate |
|---|---|
| PubChem CID | 10530075 |
| Molecular Formula | C19H13F9O5S |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | ethyl 3-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)phenyl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2cccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H13F9O5S/c1-2-32-15(29)13-7-3-5-11(9-13)12-6-4-8-14(10-12)33-34(30,31)19(27,28)17(22,23)16(20,21)18(24,25)26/h3-10H,2H2,1H3 |
| InChIKey | JVSILINXEQSOOK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|