C10H9F3N4S — CID 105301323
[1,2,5-thiadiazol-3-yl-[3-(trifluoromethyl)phenyl]methyl]hydrazine (PubChem CID 105301323) has the molecular formula C10H9F3N4S and a molecular weight of 274.27 g/mol. Its IUPAC name is [1,2,5-thiadiazol-3-yl-[3-(trifluoromethyl)phenyl]methyl]hydrazine.
| Compound Name | [1,2,5-thiadiazol-3-yl-[3-(trifluoromethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 105301323 |
| Molecular Formula | C10H9F3N4S |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [1,2,5-thiadiazol-3-yl-[3-(trifluoromethyl)phenyl]methyl]hydrazine |
| SMILES | NNC(c1cccc(C(F)(F)F)c1)c1cnsn1 |
| InChI | InChI=1S/C10H9F3N4S/c11-10(12,13)7-3-1-2-6(4-7)9(16-14)8-5-15-18-17-8/h1-5,9,16H,14H2 |
| InChIKey | ABXPCTSIGLYZFV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|