C15H20Cl2N4 — CID 105301729
[1-(2,3-dichlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine (PubChem CID 105301729) has the molecular formula C15H20Cl2N4 and a molecular weight of 327.26 g/mol. Its IUPAC name is [1-(2,3-dichlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine.
| Compound Name | [1-(2,3-dichlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105301729 |
| Molecular Formula | C15H20Cl2N4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [1-(2,3-dichlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1CCC(NN)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H20Cl2N4/c1-9-11(10(2)21(3)20-9)7-8-14(19-18)12-5-4-6-13(16)15(12)17/h4-6,14,19H,7-8,18H2,1-3H3 |
| InChIKey | SVWUEMGHFABXPK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|