C29H60O4Si3 — CID 10530836
(2R,8R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methyl-8-triethylsilyloxydec-5-yn-4-one (PubChem CID 10530836) has the molecular formula C29H60O4Si3 and a molecular weight of 557.05 g/mol. Its IUPAC name is (2R,8R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methyl-8-triethylsilyloxydec-5-yn-4-one.
| Compound Name | (2R,8R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methyl-8-triethylsilyloxydec-5-yn-4-one |
|---|---|
| PubChem CID | 10530836 |
| Molecular Formula | C29H60O4Si3 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | (2R,8R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methyl-8-triethylsilyloxydec-5-yn-4-one |
| SMILES | CC[Si](CC)(CC)O[C@](C)(CC#CC(=O)C[C@@H](C)O[Si](C)(C)C(C)(C)C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O4Si3/c1-16-36(17-2,18-3)33-29(11,22-23-31-34(12,13)27(5,6)7)21-19-20-26(30)24-25(4)32-35(14,15)28(8,9)10/h25H,16-18,21-24H2,1-15H3/t25-,29-/m1/s1 |
| InChIKey | KZYCLXUVGYCXJV-VAVYLYDRSA-N |
| XLogP | 8.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|