C21H42O3Si2 — CID 11452321
1,9-bis[[tert-butyl(dimethyl)silyl]oxy]non-4-yn-3-one (PubChem CID 11452321) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is 1,9-bis[[tert-butyl(dimethyl)silyl]oxy]non-4-yn-3-one.
| Compound Name | 1,9-bis[[tert-butyl(dimethyl)silyl]oxy]non-4-yn-3-one |
|---|---|
| PubChem CID | 11452321 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1,9-bis[[tert-butyl(dimethyl)silyl]oxy]non-4-yn-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC#CC(=O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si2/c1-20(2,3)25(7,8)23-17-14-12-11-13-15-19(22)16-18-24-26(9,10)21(4,5)6/h11-12,14,16-18H2,1-10H3 |
| InChIKey | CWLUECYXHVAJSS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|