C16H28N4 — CID 105308403
[1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-ethylimidazol-2-yl)methyl]hydrazine (PubChem CID 105308403) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is [1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-ethylimidazol-2-yl)methyl]hydrazine.
| Compound Name | [1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-ethylimidazol-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105308403 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | [1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(1-ethylimidazol-2-yl)methyl]hydrazine |
| SMILES | CCn1ccnc1C(NN)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H28N4/c1-2-20-10-9-18-16(20)15(19-17)14-8-7-12-5-3-4-6-13(12)11-14/h9-10,12-15,19H,2-8,11,17H2,1H3 |
| InChIKey | CLCDHEUIKMXLAH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|