C14H25N3 — CID 65410037
1-(3-ethylcyclopentyl)-1-(1-ethylimidazol-2-yl)-N-methylmethanamine (PubChem CID 65410037) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(3-ethylcyclopentyl)-1-(1-ethylimidazol-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3-ethylcyclopentyl)-1-(1-ethylimidazol-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 65410037 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1-(3-ethylcyclopentyl)-1-(1-ethylimidazol-2-yl)-N-methylmethanamine |
| SMILES | CCC1CCC(C(NC)c2nccn2CC)C1 |
| InChI | InChI=1S/C14H25N3/c1-4-11-6-7-12(10-11)13(15-3)14-16-8-9-17(14)5-2/h8-9,11-13,15H,4-7,10H2,1-3H3 |
| InChIKey | DDBXNVYGMSBBJV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |