C12H22N4 — CID 105233058
[(1-ethylimidazol-2-yl)-(3-methylcyclopentyl)methyl]hydrazine (PubChem CID 105233058) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is [(1-ethylimidazol-2-yl)-(3-methylcyclopentyl)methyl]hydrazine.
| Compound Name | [(1-ethylimidazol-2-yl)-(3-methylcyclopentyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105233058 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [(1-ethylimidazol-2-yl)-(3-methylcyclopentyl)methyl]hydrazine |
| SMILES | CCn1ccnc1C(NN)C1CCC(C)C1 |
| InChI | InChI=1S/C12H22N4/c1-3-16-7-6-14-12(16)11(15-13)10-5-4-9(2)8-10/h6-7,9-11,15H,3-5,8,13H2,1-2H3 |
| InChIKey | VDTJJSUPARHUBH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|