C13H14N2O2S — CID 105311989
[2,3-dihydro-1,4-benzodioxin-5-yl(thiophen-3-yl)methyl]hydrazine (PubChem CID 105311989) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is [2,3-dihydro-1,4-benzodioxin-5-yl(thiophen-3-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1,4-benzodioxin-5-yl(thiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105311989 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [2,3-dihydro-1,4-benzodioxin-5-yl(thiophen-3-yl)methyl]hydrazine |
| SMILES | NNC(c1ccsc1)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C13H14N2O2S/c14-15-12(9-4-7-18-8-9)10-2-1-3-11-13(10)17-6-5-16-11/h1-4,7-8,12,15H,5-6,14H2 |
| InChIKey | ZBDYMXDLRDYURZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|