C16H24N2S — CID 105313541
[2,3-dihydro-1-benzothiophen-3-yl-(3-methylcyclohexyl)methyl]hydrazine (PubChem CID 105313541) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is [2,3-dihydro-1-benzothiophen-3-yl-(3-methylcyclohexyl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1-benzothiophen-3-yl-(3-methylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105313541 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [2,3-dihydro-1-benzothiophen-3-yl-(3-methylcyclohexyl)methyl]hydrazine |
| SMILES | CC1CCCC(C(NN)C2CSc3ccccc32)C1 |
| InChI | InChI=1S/C16H24N2S/c1-11-5-4-6-12(9-11)16(18-17)14-10-19-15-8-3-2-7-13(14)15/h2-3,7-8,11-12,14,16,18H,4-6,9-10,17H2,1H3 |
| InChIKey | IMSIAXBGIQRDMP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|