C34H37N5O5 — CID 10531549
benzyl 4-[[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxycarbonylamino]butanoate (PubChem CID 10531549) has the molecular formula C34H37N5O5 and a molecular weight of 595.70 g/mol. Its IUPAC name is benzyl 4-[[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxycarbonylamino]butanoate.
| Compound Name | benzyl 4-[[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 10531549 |
| Molecular Formula | C34H37N5O5 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | benzyl 4-[[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl]oxycarbonylamino]butanoate |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)NCCCC(=O)OCc4ccccc4)ccc3n(C)c12 |
| InChI | InChI=1S/C34H37N5O5/c1-22-25-14-16-35-31(33(41)36-17-18-38(2)3)27(25)20-28-26-19-24(12-13-29(26)39(4)32(22)28)44-34(42)37-15-8-11-30(40)43-21-23-9-6-5-7-10-23/h5-7,9-10,12-14,16,19-20H,8,11,15,17-18,21H2,1-4H3,(H,36,41)(H,37,42) |
| InChIKey | VEJAUMJFXDPWFN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|