C13H17N5O2 — CID 105316501
[1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105316501) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316501 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | Cn1ncnc1CC(NN)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C13H17N5O2/c1-18-12(15-8-16-18)7-10(17-14)9-3-2-4-11-13(9)20-6-5-19-11/h2-4,8,10,17H,5-7,14H2,1H3 |
| InChIKey | CGGMNEXQRUJIGD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|