C15H26N4O — CID 105325481
[(2,5-dimethylpyrazol-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine (PubChem CID 105325481) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is [(2,5-dimethylpyrazol-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine.
| Compound Name | [(2,5-dimethylpyrazol-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105325481 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(2,5-dimethylpyrazol-3-yl)-(6-oxaspiro[4.5]decan-9-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)C2CCOC3(CCCC3)C2)n(C)n1 |
| InChI | InChI=1S/C15H26N4O/c1-11-9-13(19(2)18-11)14(17-16)12-5-8-20-15(10-12)6-3-4-7-15/h9,12,14,17H,3-8,10,16H2,1-2H3 |
| InChIKey | GBDIFVFLTUYQSB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|