C12H26N2O — CID 105325824
[2-methyl-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine (PubChem CID 105325824) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is [2-methyl-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine.
| Compound Name | [2-methyl-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105325824 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | [2-methyl-1-(2,4,5-trimethyloxolan-3-yl)butyl]hydrazine |
| SMILES | CCC(C)C(NN)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C12H26N2O/c1-6-7(2)12(14-13)11-8(3)9(4)15-10(11)5/h7-12,14H,6,13H2,1-5H3 |
| InChIKey | APQXQLYLOQHQLH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|