C11H12Br2N4O2S — CID 105332377
[(4,5-dibromothiophen-2-yl)-(3,5-dimethoxypyrazin-2-yl)methyl]hydrazine (PubChem CID 105332377) has the molecular formula C11H12Br2N4O2S and a molecular weight of 424.12 g/mol. Its IUPAC name is [(4,5-dibromothiophen-2-yl)-(3,5-dimethoxypyrazin-2-yl)methyl]hydrazine.
| Compound Name | [(4,5-dibromothiophen-2-yl)-(3,5-dimethoxypyrazin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105332377 |
| Molecular Formula | C11H12Br2N4O2S |
| Molecular Weight | 424.12 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | [(4,5-dibromothiophen-2-yl)-(3,5-dimethoxypyrazin-2-yl)methyl]hydrazine |
| SMILES | COc1cnc(C(NN)c2cc(Br)c(Br)s2)c(OC)n1 |
| InChI | InChI=1S/C11H12Br2N4O2S/c1-18-7-4-15-9(11(16-7)19-2)8(17-14)6-3-5(12)10(13)20-6/h3-4,8,17H,14H2,1-2H3 |
| InChIKey | YEJVUWIAWFRRLE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.12 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|