C12H18N6O2 — CID 105332293
[(3,5-dimethoxypyrazin-2-yl)-(1,5-dimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105332293) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is [(3,5-dimethoxypyrazin-2-yl)-(1,5-dimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [(3,5-dimethoxypyrazin-2-yl)-(1,5-dimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105332293 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(3,5-dimethoxypyrazin-2-yl)-(1,5-dimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | COc1cnc(C(NN)c2cnn(C)c2C)c(OC)n1 |
| InChI | InChI=1S/C12H18N6O2/c1-7-8(5-15-18(7)2)10(17-13)11-12(20-4)16-9(19-3)6-14-11/h5-6,10,17H,13H2,1-4H3 |
| InChIKey | ZDGJEOLJGURHSY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|