C13H23BrN4 — CID 105336237
[(4-bromo-1-ethylpyrazol-5-yl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine (PubChem CID 105336237) has the molecular formula C13H23BrN4 and a molecular weight of 315.26 g/mol. Its IUPAC name is [(4-bromo-1-ethylpyrazol-5-yl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine.
| Compound Name | [(4-bromo-1-ethylpyrazol-5-yl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105336237 |
| Molecular Formula | C13H23BrN4 |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [(4-bromo-1-ethylpyrazol-5-yl)-(2,2,3,3-tetramethylcyclopropyl)methyl]hydrazine |
| SMILES | CCn1ncc(Br)c1C(NN)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H23BrN4/c1-6-18-10(8(14)7-16-18)9(17-15)11-12(2,3)13(11,4)5/h7,9,11,17H,6,15H2,1-5H3 |
| InChIKey | DFFMAIQBPICJOV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|