C10H19BrN4O2S — CID 105336270
[1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-methylsulfonylpropyl]hydrazine (PubChem CID 105336270) has the molecular formula C10H19BrN4O2S and a molecular weight of 339.26 g/mol. Its IUPAC name is [1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 105336270 |
| Molecular Formula | C10H19BrN4O2S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [1-(4-bromo-1-ethylpyrazol-5-yl)-2-methyl-2-methylsulfonylpropyl]hydrazine |
| SMILES | CCn1ncc(Br)c1C(NN)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H19BrN4O2S/c1-5-15-8(7(11)6-13-15)9(14-12)10(2,3)18(4,16)17/h6,9,14H,5,12H2,1-4H3 |
| InChIKey | TXRZOFKHWSKCDP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|