C70H78N2O4Ti — CID 10534139
bis((6Z)-2,4-ditert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium (PubChem CID 10534139) has the molecular formula C70H78N2O4Ti and a molecular weight of 1059.27 g/mol. Its IUPAC name is bis((6Z)-2,4-ditert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium.
| Compound Name | bis((6Z)-2,4-ditert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium |
|---|---|
| PubChem CID | 10534139 |
| Molecular Formula | C70H78N2O4Ti |
| Molecular Weight | 1059.27 g/mol |
| Exact Mass | 1058.54 |
| IUPAC Name | bis((6Z)-2,4-ditert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium |
| SMILES | CC(C)(C)C1=C/C(=C/N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C(=O)C(C(C)(C)C)=C1.CC(C)(C)C1=C/C(=C/N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C(=O)C(C(C)(C)C)=C1.[Ti] |
| InChI | InChI=1S/2C35H39NO2.Ti/c2*1-33(2,3)29-22-26(31(37)30(23-29)34(4,5)6)24-36-32(25-16-10-7-11-17-25)35(38,27-18-12-8-13-19-27)28-20-14-9-15-21-28;/h2*7-24,32,36,38H,1-6H3;/b2*26-24-;/t2*32-;/m11./s1 |
| InChIKey | SXSSUIPQNJRDKF-OOQBMLGPSA-N |
| XLogP | 15.33 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.27 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|