C45H42N2O4 — CID 23141033
N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)-2,2-dimethylpropanediamide (PubChem CID 23141033) has the molecular formula C45H42N2O4 and a molecular weight of 674.84 g/mol. Its IUPAC name is N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23141033 |
| Molecular Formula | C45H42N2O4 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | N,N'-bis(2-hydroxy-1,2,2-triphenylethyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NC(c1ccccc1)C(O)(c1ccccc1)c1ccccc1)C(=O)NC(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H42N2O4/c1-43(2,41(48)46-39(33-21-9-3-10-22-33)44(50,35-25-13-5-14-26-35)36-27-15-6-16-28-36)42(49)47-40(34-23-11-4-12-24-34)45(51,37-29-17-7-18-30-37)38-31-19-8-20-32-38/h3-32,39-40,50-51H,1-2H3,(H,46,48)(H,47,49) |
| InChIKey | OZNLHQNEAYDNLE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|