C31H29FN2O3 — CID 44541375
N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-trityloxypropanediamide (PubChem CID 44541375) has the molecular formula C31H29FN2O3 and a molecular weight of 496.58 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-trityloxypropanediamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-trityloxypropanediamide |
|---|---|
| PubChem CID | 44541375 |
| Molecular Formula | C31H29FN2O3 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,2-dimethyl-N'-trityloxypropanediamide |
| SMILES | CC(C)(C(=O)NCc1ccc(F)cc1)C(=O)NOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29FN2O3/c1-30(2,28(35)33-22-23-18-20-27(32)21-19-23)29(36)34-37-31(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-21H,22H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | NZUPHGTUYNPGNA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|