C30H27FN2O3 — CID 44541374
N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide (PubChem CID 44541374) has the molecular formula C30H27FN2O3 and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide |
|---|---|
| PubChem CID | 44541374 |
| Molecular Formula | C30H27FN2O3 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide |
| SMILES | CC(C(=O)NCc1ccc(F)cc1)C(=O)NOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27FN2O3/c1-22(28(34)32-21-23-17-19-27(31)20-18-23)29(35)33-36-30(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-20,22H,21H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | CVEIAHCLPBYJRU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|