C37H33FN2O3 — CID 44541507
2-benzyl-N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide (PubChem CID 44541507) has the molecular formula C37H33FN2O3 and a molecular weight of 572.68 g/mol. Its IUPAC name is 2-benzyl-N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide.
| Compound Name | 2-benzyl-N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide |
|---|---|
| PubChem CID | 44541507 |
| Molecular Formula | C37H33FN2O3 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 2-benzyl-N-[(4-fluorophenyl)methyl]-2-methyl-N'-trityloxypropanediamide |
| SMILES | CC(Cc1ccccc1)(C(=O)NCc1ccc(F)cc1)C(=O)NOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H33FN2O3/c1-36(26-28-14-6-2-7-15-28,34(41)39-27-29-22-24-33(38)25-23-29)35(42)40-43-37(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-25H,26-27H2,1H3,(H,39,41)(H,40,42) |
| InChIKey | JGSFDXRSWAIZEC-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|