C24H24N2O3 — CID 10691700
N,2-dibenzyl-N'-phenylmethoxypropanediamide (PubChem CID 10691700) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N,2-dibenzyl-N'-phenylmethoxypropanediamide.
| Compound Name | N,2-dibenzyl-N'-phenylmethoxypropanediamide |
|---|---|
| PubChem CID | 10691700 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N,2-dibenzyl-N'-phenylmethoxypropanediamide |
| SMILES | O=C(NCc1ccccc1)C(Cc1ccccc1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O3/c27-23(25-17-20-12-6-2-7-13-20)22(16-19-10-4-1-5-11-19)24(28)26-29-18-21-14-8-3-9-15-21/h1-15,22H,16-18H2,(H,25,27)(H,26,28) |
| InChIKey | AGGUWPSFAYSBPN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|