C25H26N2O3 — CID 10787300
N-benzyl-2-(2-phenylethyl)-N'-phenylmethoxypropanediamide (PubChem CID 10787300) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-benzyl-2-(2-phenylethyl)-N'-phenylmethoxypropanediamide.
| Compound Name | N-benzyl-2-(2-phenylethyl)-N'-phenylmethoxypropanediamide |
|---|---|
| PubChem CID | 10787300 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-benzyl-2-(2-phenylethyl)-N'-phenylmethoxypropanediamide |
| SMILES | O=C(NCc1ccccc1)C(CCc1ccccc1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O3/c28-24(26-18-21-12-6-2-7-13-21)23(17-16-20-10-4-1-5-11-20)25(29)27-30-19-22-14-8-3-9-15-22/h1-15,23H,16-19H2,(H,26,28)(H,27,29) |
| InChIKey | NNAQCGPQCSQHLJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|